Compound Q&A

What precautions should be taken when handling 2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide] (CAS: 4531-49-1)?

Answer

2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide]
When handling this compound, it is essential to use proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize inhalation risks. Follow strict waste disposal protocols and refer to the Safety Data Sheet (SDS) for detailed handling instructions.

About

CAS No 4531-49-1
English Name 2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide]
Molecular Formula C34H30Cl2N6O6
Molecular Weight 689.56 g/mol
SMILES CC(=O)C(/N=N/c1c(cc(cc1)c2cc(c(cc2)/N=N/C(C(=O)Nc3c(cccc3)OC)C(=O)C)Cl)Cl)C(=O)Nc4c(cccc4)OC
InChIKey VTGOEJALMFECDQ-LMXNTIJMSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide] (CAS: 4531-49-1)?

The compound is a crystalline solid with a high molecular weight due to its complex structure. It ha...

Compound Q&A

How is 2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide] (CAS: 4531-49-1) typically synthesized?

This compound is typically synthesized via a multi-step process involving diazocyclization and amide...

Compound Q&A

What industries use 2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide] (CAS: 4531-49-1)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...