Compound Q&A

What industries use 2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide] (CAS: 4531-49-1)?

Answer

2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide]
This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic molecules. It also finds use in the development of advanced organic electronic materials, such as polymers and semiconductors, due to its unique electronic properties.

About

CAS No 4531-49-1
English Name 2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide]
Molecular Formula C34H30Cl2N6O6
Molecular Weight 689.56 g/mol
SMILES CC(=O)C(/N=N/c1c(cc(cc1)c2cc(c(cc2)/N=N/C(C(=O)Nc3c(cccc3)OC)C(=O)C)Cl)Cl)C(=O)Nc4c(cccc4)OC
InChIKey VTGOEJALMFECDQ-LMXNTIJMSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide] (CAS: 4531-49-1)?

The compound is a crystalline solid with a high molecular weight due to its complex structure. It ha...

Compound Q&A

How is 2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide] (CAS: 4531-49-1) typically synthesized?

This compound is typically synthesized via a multi-step process involving diazocyclization and amide...

Compound Q&A

What precautions should be taken when handling 2,2'-[(3,3'-Dichloro-4,4'-biphenyldiyl)di(E)-2,1-diazenediyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide] (CAS: 4531-49-1)?

When handling this compound, it is essential to use proper personal protective equipment (PPE) such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...