Compound Q&A

How is Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate) (CAS: 89452-37-9) typically synthesized?

Answer

Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate)
Bis[4-(Diphenylsulfonio)phenyl] sulfide bis(hexafluoroantimonate) is synthesized through a multi-step process involving the formation of the diphenylsulfonium salt, followed by its reaction with bis(hexafluoroantimonate). The synthesis typically requires the use of anhydrous conditions and inert atmospheres to prevent decomposition. The exact methods can vary based on the desired purity and yield.

About

CAS No 89452-37-9
English Name Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate)
Molecular Formula C36H28F12S3Sb2
Molecular Weight 1028.3 g/mol
SMILES C1=CC=C(C=C1)[S+](C2=CC=CC=C2)C3=CC=C(C=C3)SC4=CC=C(C=C4)[S+](C5=CC=CC=C5)C6=CC=CC=C6.F[Sb-](F)(F)(F)(F)F.F[Sb-](F)(F)(F)(F)F
InChIKey DREXYWKFHDOSNT-UHFFFAOYSA-B
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate) (CAS: 89452-37-9)?

Bis[4-(Diphenylsulfonio)phenyl] sulfide bis(hexafluoroantimonate) is a crystalline solid with a high...

Compound Q&A

What industries use Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate) (CAS: 89452-37-9)?

Bis[4-(Diphenylsulfonio)phenyl] sulfide bis(hexafluoroantimonate) finds applications in the pharmace...

Compound Q&A

What precautions should be taken when handling Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate) (CAS: 89452-37-9)?

When handling Bis[4-(Diphenylsulfonio)phenyl] sulfide bis(hexafluoroantimonate), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...