Compound Q&A

What are the physical and chemical properties of Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate) (CAS: 89452-37-9)?

Answer

Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate)
Bis[4-(Diphenylsulfonio)phenyl] sulfide bis(hexafluoroantimonate) is a crystalline solid with a high molecular weight. It has limited solubility in common organic solvents but excellent solubility in some polar aprotic solvents. The compound is known for its high reactivity, particularly in nucleophilic substitution reactions. It is used in various applications due to its unique chemical properties.

About

CAS No 89452-37-9
English Name Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate)
Molecular Formula C36H28F12S3Sb2
Molecular Weight 1028.3 g/mol
SMILES C1=CC=C(C=C1)[S+](C2=CC=CC=C2)C3=CC=C(C=C3)SC4=CC=C(C=C4)[S+](C5=CC=CC=C5)C6=CC=CC=C6.F[Sb-](F)(F)(F)(F)F.F[Sb-](F)(F)(F)(F)F
InChIKey DREXYWKFHDOSNT-UHFFFAOYSA-B
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate) (CAS: 89452-37-9) typically synthesized?

Bis[4-(Diphenylsulfonio)phenyl] sulfide bis(hexafluoroantimonate) is synthesized through a multi-ste...

Compound Q&A

What industries use Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate) (CAS: 89452-37-9)?

Bis[4-(Diphenylsulfonio)phenyl] sulfide bis(hexafluoroantimonate) finds applications in the pharmace...

Compound Q&A

What precautions should be taken when handling Bis[4-(Diphenylsulfonio)phenyl] Sulfide Bis(hexafluoroantimonate) (CAS: 89452-37-9)?

When handling Bis[4-(Diphenylsulfonio)phenyl] sulfide bis(hexafluoroantimonate), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...