Compound Q&A

How is 2,4-Dichloro-6-nitrophenol (CAS: 609-89-2) typically synthesized?

Answer

2,4-Dichloro-6-nitrophenol
2,4-Dichloro-6-nitrophenol is typically synthesized by the nitration of 2,4-dichlorophenol. Common methods involve the use of concentrated nitric acid and sulfuric acid as the nitrating agent. The process requires careful control of temperature and reactant concentration to achieve high yield and selectivity.

About

CAS No 609-89-2
English Name 2,4-Dichloro-6-nitrophenol
Molecular Formula C6H3Cl2NO3
Molecular Weight 208 g/mol
SMILES C1=C(C=C(C(=C1[N+](=O)[O-])O)Cl)Cl
InChIKey LYPMXMBQPXPNIQ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-6-nitrophenol (CAS: 609-89-2)?

2,4-Dichloro-6-nitrophenol is a crystalline solid with a molecular weight of 215.01 g/mol. It has a ...

Compound Q&A

What industries use 2,4-Dichloro-6-nitrophenol (CAS: 609-89-2)?

2,4-Dichloro-6-nitrophenol is used in the pharmaceutical industry for the synthesis of certain drugs...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-6-nitrophenol (CAS: 609-89-2)?

When handling 2,4-Dichloro-6-nitrophenol, it is essential to use personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...