Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-6-nitrophenol (CAS: 609-89-2)?

Answer

2,4-Dichloro-6-nitrophenol
2,4-Dichloro-6-nitrophenol is a crystalline solid with a molecular weight of 215.01 g/mol. It has a solubility of 0.014 g/L in water. Chemically, it is reactive towards bases and can undergo reductions and hydrolysis. It is slightly soluble in ethanol and acetone.

About

CAS No 609-89-2
English Name 2,4-Dichloro-6-nitrophenol
Molecular Formula C6H3Cl2NO3
Molecular Weight 208 g/mol
SMILES C1=C(C=C(C(=C1[N+](=O)[O-])O)Cl)Cl
InChIKey LYPMXMBQPXPNIQ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 2,4-Dichloro-6-nitrophenol (CAS: 609-89-2) typically synthesized?

2,4-Dichloro-6-nitrophenol is typically synthesized by the nitration of 2,4-dichlorophenol. Common m...

Compound Q&A

What industries use 2,4-Dichloro-6-nitrophenol (CAS: 609-89-2)?

2,4-Dichloro-6-nitrophenol is used in the pharmaceutical industry for the synthesis of certain drugs...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-6-nitrophenol (CAS: 609-89-2)?

When handling 2,4-Dichloro-6-nitrophenol, it is essential to use personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...