Compound Q&A

How is 5,6-Dichloropicolinic acid (CAS: 88912-24-7) typically synthesized?

Answer

5,6-Dichloropicolinic acid
5,6-Dichloropicolinic acid can be synthesized via the chlorination of picolinic acid under appropriate conditions. A common method involves treating picolinic acid with chlorine gas in the presence of a suitable catalyst, such as ferric chloride, to selectively introduce the dichloro substituents. The yield and selectivity of the reaction can be significantly influenced by the reaction conditions and the choice of catalyst.

About

CAS No 88912-24-7
English Name 5,6-Dichloropicolinic acid
Molecular Formula C6H3Cl2NO2
Molecular Weight 192 g/mol
SMILES C1=CC(=NC(=C1Cl)Cl)C(=O)O
InChIKey QOJNAEPFSUYAFL-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,6-Dichloropicolinic acid (CAS: 88912-24-7)?

5,6-Dichloropicolinic acid (CAS: 88912-24-7) is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use 5,6-Dichloropicolinic acid (CAS: 88912-24-7)?

5,6-Dichloropicolinic acid is used in various industries. It is a key intermediate in the synthesis ...

Compound Q&A

What precautions should be taken when handling 5,6-Dichloropicolinic acid (CAS: 88912-24-7)?

When handling 5,6-Dichloropicolinic acid (CAS: 88912-24-7), it is important to use personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...