Compound Q&A

What precautions should be taken when handling (2-Formyl-4-methoxyphenyl)boronic acid (CAS: 139962-95-1)?

Answer

(2-Formyl-4-methoxyphenyl)boronic acid
When handling (2-Formyl-4-methoxyphenyl)boronic acid, it is important to use personal protective equipment (PPE), including gloves and safety glasses. Store the compound in a fume hood and handle it in a well-ventilated area. In case of a spill, use appropriate absorbents and follow the Material Safety Data Sheet (MSDS) guidelines for disposal.

About

English Name (2-Formyl-4-methoxyphenyl)boronic acid
Molecular Formula C8H9BO4
Molecular Weight 179.97 g/mol
SMILES B(C1=C(C=C(C=C1)OC)C=O)(O)O
InChIKey ZSSNGMFKYFBOAG-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Formyl-4-methoxyphenyl)boronic acid (CAS: 139962-95-1)?

(2-Formyl-4-methoxyphenyl)boronic acid is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is (2-Formyl-4-methoxyphenyl)boronic acid (CAS: 139962-95-1) typically synthesized?

(2-Formyl-4-methoxyphenyl)boronic acid is commonly synthesized through the coupling of 2-formyl-4-me...

Compound Q&A

What industries use (2-Formyl-4-methoxyphenyl)boronic acid (CAS: 139962-95-1)?

(2-Formyl-4-methoxyphenyl)boronic acid is primarily used in the pharmaceutical and chemical industri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...