Compound Q&A

How is 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside (CAS: 64291-41-4) typically synthesized?

Answer

4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside
4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside is typically synthesized via a multi-step process involving the acetylation of a glucopyranoside with 4-hydroxymethylphenol. This involves the use of acetic anhydride and a suitable catalyst, such as acetic acid or a Lewis acid. The reaction yields a white solid with high purity, and the process is carried out under mild conditions to ensure high selectivity and yield.

About

CAS No 64291-41-4
English Name 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside
Molecular Formula C21H26O11
Molecular Weight 454.43 g/mol
SMILES OCC1=CC=C(O[C@H]2[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O2)C=C1
InChIKey HGUDVDQXCUHOED-YMQHIKHWSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside (CAS: 64291-41-4)?

4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside is a white crystalline solid w...

Compound Q&A

What industries use 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside (CAS: 64291-41-4)?

4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside (CAS: 64291-41-4)?

When handling 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside, it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...