Compound Q&A

What are the physical and chemical properties of 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside (CAS: 64291-41-4)?

Answer

4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside
4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside is a white crystalline solid with a molecular weight of approximately 617.6 g/mol. It has limited water solubility but is soluble in various organic solvents. Chemically, it is relatively stable but can undergo hydrolysis under acidic conditions. Its reactivity is moderate, and it is typically used in synthetic chemistry and pharmaceutical applications.

About

CAS No 64291-41-4
English Name 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside
Molecular Formula C21H26O11
Molecular Weight 454.43 g/mol
SMILES OCC1=CC=C(O[C@H]2[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O2)C=C1
InChIKey HGUDVDQXCUHOED-YMQHIKHWSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside (CAS: 64291-41-4) typically synthesized?

4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside is typically synthesized via a...

Compound Q&A

What industries use 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside (CAS: 64291-41-4)?

4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside (CAS: 64291-41-4)?

When handling 4-(Hydroxymethyl)phenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside, it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...