Compound Q&A

What precautions should be taken when handling Fosfluconazole (CAS: 194798-83-9)?

Answer

Fosfluconazole
When handling Fosfluconazole (CAS: 194798-83-9), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be handled in a well-ventilated area or a fume hood due to its potential for volatility and reactivity. Spills should be cleaned up with caution, and the area should be decontaminated. Always refer to the Safety Data Sheet (SDS) for detailed emergency procedures and handling guidelines.

About

English Name Fosfluconazole
Molecular Formula C13H13F2N6O4P
Molecular Weight 386.25 g/mol
SMILES C1=CC(=C(C=C1F)F)C(CN2C=NC=N2)(CN3C=NC=N3)OP(=O)(O)O
InChIKey GHJWNRRCRIGGIO-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fosfluconazole (CAS: 194798-83-9)?

Fosfluconazole (CAS: 194798-83-9) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

How is Fosfluconazole (CAS: 194798-83-9) typically synthesized?

Fosfluconazole (CAS: 194798-83-9) is typically synthesized through a multi-step process involving am...

Compound Q&A

What industries use Fosfluconazole (CAS: 194798-83-9)?

Fosfluconazole (CAS: 194798-83-9) is primarily used in the pharmaceutical industry as an antifungal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...