Compound Q&A

How is 3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9) typically synthesized?

Answer

3,5-Dimethyl-4-nitropyridine 1-oxide
3,5-Dimethyl-4-nitropyridine 1-oxide is typically synthesized via the nitration of 3,5-dimethylpyridine followed by oxidation. Common reagents for nitration include nitric acid and sulfuric acid. Oxidation can be achieved using potassium permanganate or other strong oxidizing agents to convert the nitro group to the 1-oxide form.

About

CAS No 14248-66-9
English Name 3,5-Dimethyl-4-nitropyridine 1-oxide
Molecular Formula C7H8N2O3
Molecular Weight 168.15 g/mol
SMILES CC1=C[N+](=CC(=C1[N+](=O)[O-])C)[O-]
InChIKey VLKVMXPKEDVNBO-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9)?

3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9) is a solid with a crystalline form. Its molec...

Compound Q&A

What industries use 3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9)?

3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9)?

When handling 3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9), always use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...