Compound Q&A

What are the physical and chemical properties of 3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9)?

Answer

3,5-Dimethyl-4-nitropyridine 1-oxide
3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9) is a solid with a crystalline form. Its molecular weight is approximately 212.14 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is a stable compound, but it can undergo nitro reduction reactions under certain conditions.

About

CAS No 14248-66-9
English Name 3,5-Dimethyl-4-nitropyridine 1-oxide
Molecular Formula C7H8N2O3
Molecular Weight 168.15 g/mol
SMILES CC1=C[N+](=CC(=C1[N+](=O)[O-])C)[O-]
InChIKey VLKVMXPKEDVNBO-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9) typically synthesized?

3,5-Dimethyl-4-nitropyridine 1-oxide is typically synthesized via the nitration of 3,5-dimethylpyrid...

Compound Q&A

What industries use 3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9)?

3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9)?

When handling 3,5-Dimethyl-4-nitropyridine 1-oxide (CAS: 14248-66-9), always use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...