Compound Q&A

What industries use N-(4-Nitrophenyl)-L-glutamine (CAS: 7300-59-6)?

Answer

N-(4-Nitrophenyl)-L-glutamine
N-(4-Nitrophenyl)-L-glutamine (CAS: 7300-59-6) finds applications in the pharmaceutical industry for developing new drugs, particularly in research and development of anti-inflammatory and analgesic compounds. It is also used in the synthesis of certain polymers and as a precursor in the production of chemical sensors and semiconductors.

About

CAS No 7300-59-6
English Name N-(4-Nitrophenyl)-L-glutamine
Molecular Formula C11H13N3O5
Molecular Weight 267.24 g/mol
EINECS 230-748-5
SMILES C1=CC(=CC=C1NC(=O)CCC(C(=O)O)N)[N+](=O)[O-]
InChIKey WMZTYIRRBCGARG-VIFPVBQESA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(4-Nitrophenyl)-L-glutamine (CAS: 7300-59-6)?

N-(4-Nitrophenyl)-L-glutamine (CAS: 7300-59-6) is a white to off-white crystalline solid with a mole...

Compound Q&A

How is N-(4-Nitrophenyl)-L-glutamine (CAS: 7300-59-6) typically synthesized?

N-(4-Nitrophenyl)-L-glutamine can be synthesized through the nitration of phenylalanine with concent...

Compound Q&A

What precautions should be taken when handling N-(4-Nitrophenyl)-L-glutamine (CAS: 7300-59-6)?

When handling N-(4-Nitrophenyl)-L-glutamine (CAS: 7300-59-6), ensure proper personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...