Compound Q&A

What industries use 2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)] (CAS: 181028-79-5)?

Answer

2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)]
This compound is used in pharmaceuticals for its role as a phosphate donor in certain therapeutic applications. It is also employed in polymer chemistry for the modification of polymer properties and in the development of sensors and semiconductors.

About

English Name 2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)]
Molecular Formula C15H18O8P2
Molecular Weight 388.25 g/mol
SMILES CC(C)(C1=CC=C(C=C1)OP(=O)(O)O)C2=CC=C(C=C2)OP(=O)(O)O
InChIKey LAUIXFSZFKWUCT-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)] (CAS: 181028-79-5)?

The compound has a crystalline form and a molecular weight of approximately 274.14 g/mol. It shows g...

Compound Q&A

How is 2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)] (CAS: 181028-79-5) typically synthesized?

This compound can be synthesized by the esterification of a phenol with a diester of a dicarboxylic ...

Compound Q&A

What precautions should be taken when handling 2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)] (CAS: 181028-79-5)?

When handling this compound, use appropriate personal protective equipment (PPE) such as gloves, gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...