Compound Q&A

What are the physical and chemical properties of 2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)] (CAS: 181028-79-5)?

Answer

2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)]
The compound has a crystalline form and a molecular weight of approximately 274.14 g/mol. It shows good solubility in polar solvents like water and dimethylformamide. Chemically, it exhibits reactivity towards nucleophiles and can be used as a phosphate donor. It is stable under normal conditions but decomposes at high temperatures.

About

English Name 2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)]
Molecular Formula C15H18O8P2
Molecular Weight 388.25 g/mol
SMILES CC(C)(C1=CC=C(C=C1)OP(=O)(O)O)C2=CC=C(C=C2)OP(=O)(O)O
InChIKey LAUIXFSZFKWUCT-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)] (CAS: 181028-79-5) typically synthesized?

This compound can be synthesized by the esterification of a phenol with a diester of a dicarboxylic ...

Compound Q&A

What industries use 2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)] (CAS: 181028-79-5)?

This compound is used in pharmaceuticals for its role as a phosphate donor in certain therapeutic ap...

Compound Q&A

What precautions should be taken when handling 2,2-Propanediyldi-4,1-phenylene bis[dihydrogen (phosphate)] (CAS: 181028-79-5)?

When handling this compound, use appropriate personal protective equipment (PPE) such as gloves, gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...