Compound Q&A

What precautions should be taken when handling 2,4-Difluoro-1-(trifluoromethyl)benzene (CAS: 64248-61-9)?

Answer

2,4-Difluoro-1-(trifluoromethyl)benzene
When handling 2,4-Difluoro-1-(trifluoromethyl)benzene, care should be taken to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up carefully, and the material safety data sheet (MSDS) should be consulted for specific disposal instructions. This compound is not flammable, but care must be taken due to its reactivity and potential for skin and eye irritation.

About

CAS No 64248-61-9
English Name 2,4-Difluoro-1-(trifluoromethyl)benzene
Molecular Formula C7H3F5
Molecular Weight 182.09 g/mol
SMILES C1=CC(=C(C=C1F)F)C(F)(F)F
InChIKey PQJOLFTWPSZESR-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Difluoro-1-(trifluoromethyl)benzene (CAS: 64248-61-9)?

2,4-Difluoro-1-(trifluoromethyl)benzene has a crystalline form and a molecular weight of approximate...

Compound Q&A

How is 2,4-Difluoro-1-(trifluoromethyl)benzene (CAS: 64248-61-9) typically synthesized?

2,4-Difluoro-1-(trifluoromethyl)benzene is typically synthesized through the Friedel-Crafts alkylati...

Compound Q&A

What industries use 2,4-Difluoro-1-(trifluoromethyl)benzene (CAS: 64248-61-9)?

2,4-Difluoro-1-(trifluoromethyl)benzene finds applications in the pharmaceutical industry for the sy...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...