Compound Q&A

What industries use 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3)?

Answer

5-Chloro-6-methoxynicotinic acid
5-Chloro-6-methoxynicotinic acid is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the chemical industry for the production of various organic compounds and in research for developing new materials, such as sensors and semiconductors.

About

English Name 5-Chloro-6-methoxynicotinic acid
Molecular Formula C7H6ClNO3
Molecular Weight 187.58 g/mol
SMILES COC1=C(C=C(C=N1)C(=O)O)Cl
InChIKey FUBFUAARMGZWPE-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3)?

5-Chloro-6-methoxynicotinic acid is a white crystalline solid. Its molecular weight is approximately...

Compound Q&A

How is 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3) typically synthesized?

5-Chloro-6-methoxynicotinic acid is typically synthesized through the methylation of nicotinic acid ...

Compound Q&A

What precautions should be taken when handling 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3)?

When handling 5-Chloro-6-methoxynicotinic acid, proper personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...