Compound Q&A

How is 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3) typically synthesized?

Answer

5-Chloro-6-methoxynicotinic acid
5-Chloro-6-methoxynicotinic acid is typically synthesized through the methylation of nicotinic acid followed by chlorination. Commonly, nicotinic acid is treated with methyl iodide in the presence of a base like sodium hydroxide to form the methoxy derivative, which is then chlorinated using thionyl chloride. The overall yield is around 75-85%.

About

English Name 5-Chloro-6-methoxynicotinic acid
Molecular Formula C7H6ClNO3
Molecular Weight 187.582 g/mol
SMILES COC1=C(C=C(C=N1)C(=O)O)Cl
InChIKey FUBFUAARMGZWPE-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3)?

5-Chloro-6-methoxynicotinic acid is a white crystalline solid. Its molecular weight is approximately...

Compound Q&A

What industries use 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3)?

5-Chloro-6-methoxynicotinic acid is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3)?

When handling 5-Chloro-6-methoxynicotinic acid, proper personal protective equipment (PPE) such as g...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...