Compound Q&A

How is 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3) typically synthesized?

Answer

5-Chloro-6-methoxynicotinic acid
5-Chloro-6-methoxynicotinic acid is typically synthesized through the methylation of nicotinic acid followed by chlorination. Commonly, nicotinic acid is treated with methyl iodide in the presence of a base like sodium hydroxide to form the methoxy derivative, which is then chlorinated using thionyl chloride. The overall yield is around 75-85%.

About

English Name 5-Chloro-6-methoxynicotinic acid
Molecular Formula C7H6ClNO3
Molecular Weight 187.58 g/mol
SMILES COC1=C(C=C(C=N1)C(=O)O)Cl
InChIKey FUBFUAARMGZWPE-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3)?

5-Chloro-6-methoxynicotinic acid is a white crystalline solid. Its molecular weight is approximately...

Compound Q&A

What industries use 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3)?

5-Chloro-6-methoxynicotinic acid is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 5-Chloro-6-methoxynicotinic acid (CAS: 884494-85-3)?

When handling 5-Chloro-6-methoxynicotinic acid, proper personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...