Compound Q&A

What industries use 5-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-65-0)?

Answer

5-Methyl-2,3-pyridinedicarboxylic acid
5-Methyl-2,3-pyridinedicarboxylic acid finds applications in various industries, including pharmaceuticals, where it is used as a precursor in the synthesis of certain drugs, and in the polymer industry for the production of specific types of plastics. It also has uses in sensor technology and semiconductor manufacturing.

About

CAS No 53636-65-0
English Name 5-Methyl-2,3-pyridinedicarboxylic acid
Molecular Formula C8H7NO4
Molecular Weight 181.15 g/mol
SMILES CC1=CC(=C(N=C1)C(=O)O)C(=O)O
InChIKey JPIJMXOJEHMTPU-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-65-0)?

5-Methyl-2,3-pyridinedicarboxylic acid is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is 5-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-65-0) typically synthesized?

5-Methyl-2,3-pyridinedicarboxylic acid is synthesized through the condensation of 3-chloro-2-methylp...

Compound Q&A

What precautions should be taken when handling 5-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-65-0)?

When handling 5-Methyl-2,3-pyridinedicarboxylic acid, it is crucial to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...