Compound Q&A

How is 5-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-65-0) typically synthesized?

Answer

5-Methyl-2,3-pyridinedicarboxylic acid
5-Methyl-2,3-pyridinedicarboxylic acid is synthesized through the condensation of 3-chloro-2-methylpyridine with maleic anhydride. The process involves the use of a suitable catalyst and typically results in a yield of around 80-85%. The reaction is performed in an inert atmosphere to avoid side reactions.

About

CAS No 53636-65-0
English Name 5-Methyl-2,3-pyridinedicarboxylic acid
Molecular Formula C8H7NO4
Molecular Weight 181.15 g/mol
SMILES CC1=CC(=C(N=C1)C(=O)O)C(=O)O
InChIKey JPIJMXOJEHMTPU-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-65-0)?

5-Methyl-2,3-pyridinedicarboxylic acid is a white crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use 5-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-65-0)?

5-Methyl-2,3-pyridinedicarboxylic acid finds applications in various industries, including pharmaceu...

Compound Q&A

What precautions should be taken when handling 5-Methyl-2,3-pyridinedicarboxylic acid (CAS: 53636-65-0)?

When handling 5-Methyl-2,3-pyridinedicarboxylic acid, it is crucial to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...