Compound Q&A

What are the physical and chemical properties of Ethyl 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate (CAS: 1224944-77-7)?

Answer

Ethyl 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate
Ethyl 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate (CAS: 1224944-77-7) is a white crystalline solid with a molecular weight of 241.57 g/mol. It is soluble in polar solvents such as methanol and acetone but has low solubility in water. This compound is known for its high reactivity, particularly in nucleophilic substitution reactions.

About

English Name Ethyl 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate
Molecular Formula C9H8ClN3O2
Molecular Weight 225.64 g/mol
SMILES CCOC(=O)C1=C2N=C(C=CN2N=C1)Cl
InChIKey UOZKVCQDLXBWBG-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is Ethyl 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate (CAS: 1224944-77-7) typically synthesized?

Ethyl 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate (CAS: 1224944-77-7) is synthesized through a m...

Compound Q&A

What industries use Ethyl 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate (CAS: 1224944-77-7)?

Ethyl 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate (CAS: 1224944-77-7) is used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling Ethyl 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate (CAS: 1224944-77-7)?

When handling Ethyl 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate (CAS: 1224944-77-7), it is impor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...