Compound Q&A

What industries use Sodium 1-amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonate (CAS: 6258-06-6)?

Answer

Sodium 1-amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonate
Sodium 1-amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonate (CAS: 6258-06-6) is used in the pharmaceutical industry for the synthesis of specific compounds due to its unique chemical structure. It is also utilized in the polymer industry for the development of advanced materials, and in the sensor industry for its potential in detecting certain chemical species. Additionally, it may have applications in the semiconductor industry due to its electronic properties.

About

CAS No 6258-06-6
English Name Sodium 1-amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonate
Molecular Formula C14H7BrNNaO5S
Molecular Weight 404.17 g/mol
SMILES Brc1cc(c(c2c1C(=O)c1ccccc1C2=O)N)S(=O)(=O)[O-].[Na+]
InChIKey TXMRAEGWZZVGIH-UHFFFAOYSA-M
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 1-amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonate (CAS: 6258-06-6)?

Sodium 1-amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonate (CAS: 6258-06-6) is a crystalli...

Compound Q&A

How is Sodium 1-amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonate (CAS: 6258-06-6) typically synthesized?

Sodium 1-amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonate is typically synthesized via th...

Compound Q&A

What precautions should be taken when handling Sodium 1-amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonate (CAS: 6258-06-6)?

When handling Sodium 1-amino-4-bromo-9,10-dioxo-9,10-dihydro-2-anthracenesulfonate (CAS: 6258-06-6),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...