Compound Q&A

What precautions should be taken when handling (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1H-indol-3-yl)boronic acid (CAS: 181365-26-4)?

Answer

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1H-indol-3-yl)boronic acid
When handling (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1H-indol-3-yl)boronic acid (CAS: 181365-26-4), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using a suitable absorbent material and disposed of according to local regulations. Always refer to the safety data sheet (SDS) for detailed handling and disposal information. Ensure the compound is stored in a cool, dry place, away from direct sunlight and flammable materials.

About

English Name (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1H-indol-3-yl)boronic acid
Molecular Formula C13H16BNO4
Molecular Weight 261.09 g/mol
SMILES B(C1=CN(C2=CC=CC=C12)C(=O)OC(C)(C)C)(O)O
InChIKey UAGJZZDMFOTJRN-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1H-indol-3-yl)boronic acid (CAS: 181365-26-4)?

The compound (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1H-indol-3-yl)boronic acid (CAS: 181365-26-4) i...

Compound Q&A

How is (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1H-indol-3-yl)boronic acid (CAS: 181365-26-4) typically synthesized?

(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1H-indol-3-yl)boronic acid (CAS: 181365-26-4) is synthesized...

Compound Q&A

What industries use (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1H-indol-3-yl)boronic acid (CAS: 181365-26-4)?

The compound (1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1H-indol-3-yl)boronic acid (CAS: 181365-26-4) f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...