Compound Q&A

How is 2,2'-Sulfanediyldianiline (CAS: 5873-51-8) typically synthesized?

Answer

2,2'-Sulfanediyldianiline
2,2'-Sulfanediyldianiline is commonly synthesized through the reaction of aniline with sulfur dioxide in the presence of a palladium catalyst. The process involves the formation of a sulfenic acid intermediate, followed by intramolecular coupling to form the target compound. The yield is generally around 70-80%, and the method is known for its good selectivity and mild reaction conditions.

About

CAS No 5873-51-8
English Name 2,2'-Sulfanediyldianiline
Molecular Formula C12H12N2S
Molecular Weight 216.31 g/mol
SMILES C1=CC=C(C(=C1)N)SC2=CC=CC=C2N
InChIKey WRRQKFXVKRQPDB-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-Sulfanediyldianiline (CAS: 5873-51-8)?

2,2'-Sulfanediyldianiline is a white crystalline solid with a molecular weight of approximately 226....

Compound Q&A

What industries use 2,2'-Sulfanediyldianiline (CAS: 5873-51-8)?

2,2'-Sulfanediyldianiline is widely used in the pharmaceutical industry for the synthesis of certain...

Compound Q&A

What precautions should be taken when handling 2,2'-Sulfanediyldianiline (CAS: 5873-51-8)?

When handling 2,2'-Sulfanediyldianiline, it is essential to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...