Compound Q&A

What are the physical and chemical properties of 2,2'-Sulfanediyldianiline (CAS: 5873-51-8)?

Answer

2,2'-Sulfanediyldianiline
2,2'-Sulfanediyldianiline is a white crystalline solid with a molecular weight of approximately 226.27 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, particularly towards nucleophilic substitution reactions, making it suitable for various chemical modifications. It has a melting point of 125-127°C and a density of around 1.3 g/cm³.

About

CAS No 5873-51-8
English Name 2,2'-Sulfanediyldianiline
Molecular Formula C12H12N2S
Molecular Weight 216.31 g/mol
SMILES C1=CC=C(C(=C1)N)SC2=CC=CC=C2N
InChIKey WRRQKFXVKRQPDB-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 2,2'-Sulfanediyldianiline (CAS: 5873-51-8) typically synthesized?

2,2'-Sulfanediyldianiline is commonly synthesized through the reaction of aniline with sulfur dioxid...

Compound Q&A

What industries use 2,2'-Sulfanediyldianiline (CAS: 5873-51-8)?

2,2'-Sulfanediyldianiline is widely used in the pharmaceutical industry for the synthesis of certain...

Compound Q&A

What precautions should be taken when handling 2,2'-Sulfanediyldianiline (CAS: 5873-51-8)?

When handling 2,2'-Sulfanediyldianiline, it is essential to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...