Compound Q&A

What industries use 6-Bromo-3-quinolinecarboxylic acid (CAS: 798545-30-9)?

Answer

6-Bromo-3-quinolinecarboxylic acid
6-Bromo-3-quinolinecarboxylic acid is used in the pharmaceutical and chemical industries for the synthesis of various drugs and intermediates. It also finds applications in the production of dyes, pigments, and as a precursor in the development of new materials such as polymers and sensors.

About

English Name 6-Bromo-3-quinolinecarboxylic acid
Molecular Formula C10H6BrNO2
Molecular Weight 252.07 g/mol
SMILES C1=CC2=NC=C(C=C2C=C1Br)C(=O)O
InChIKey HVNYDSMSHWJYHG-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-3-quinolinecarboxylic acid (CAS: 798545-30-9)?

6-Bromo-3-quinolinecarboxylic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

How is 6-Bromo-3-quinolinecarboxylic acid (CAS: 798545-30-9) typically synthesized?

6-Bromo-3-quinolinecarboxylic acid is commonly synthesized via bromination of 3-quinolinecarboxylic ...

Compound Q&A

What precautions should be taken when handling 6-Bromo-3-quinolinecarboxylic acid (CAS: 798545-30-9)?

When handling 6-Bromo-3-quinolinecarboxylic acid, it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...