Compound Q&A

What are the physical and chemical properties of 6-Bromo-3-quinolinecarboxylic acid (CAS: 798545-30-9)?

Answer

6-Bromo-3-quinolinecarboxylic acid
6-Bromo-3-quinolinecarboxylic acid is a crystalline solid with a molecular weight of approximately 240.04 g/mol. It has a pKa of around 1.6 and is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. It exhibits good reactivity towards nucleophiles and can be used in various synthesis reactions.

About

English Name 6-Bromo-3-quinolinecarboxylic acid
Molecular Formula C10H6BrNO2
Molecular Weight 252.07 g/mol
SMILES C1=CC2=NC=C(C=C2C=C1Br)C(=O)O
InChIKey HVNYDSMSHWJYHG-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 6-Bromo-3-quinolinecarboxylic acid (CAS: 798545-30-9) typically synthesized?

6-Bromo-3-quinolinecarboxylic acid is commonly synthesized via bromination of 3-quinolinecarboxylic ...

Compound Q&A

What industries use 6-Bromo-3-quinolinecarboxylic acid (CAS: 798545-30-9)?

6-Bromo-3-quinolinecarboxylic acid is used in the pharmaceutical and chemical industries for the syn...

Compound Q&A

What precautions should be taken when handling 6-Bromo-3-quinolinecarboxylic acid (CAS: 798545-30-9)?

When handling 6-Bromo-3-quinolinecarboxylic acid, it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...