Compound Q&A

How is benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2) typically synthesized?

Answer

benzyl 2-(dimethyl phosphono)acetate
Benzyl 2-(dimethyl phosphono)acetate is typically synthesized through esterification of dimethyl phosphonate with acetophenone using a suitable acid catalyst at elevated temperatures. The reaction yields a high purity product with good selectivity and yield, making it a useful intermediate in organic synthesis.

About

CAS No 57443-18-2
English Name benzyl 2-(dimethyl phosphono)acetate
Molecular Formula C11H15O5P
Molecular Weight 258.21 g/mol
SMILES COP(=O)(CC(=O)OCC1=CC=CC=C1)OC
InChIKey QYLGNJMIOVHLQQ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2)?

Benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2) is a colorless or slightly yellow liquid with...

Compound Q&A

What industries use benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2)?

Benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2)?

When handling benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2), it is essential to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...