Compound Q&A

What are the physical and chemical properties of benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2)?

Answer

benzyl 2-(dimethyl phosphono)acetate
Benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2) is a colorless or slightly yellow liquid with a molecular weight of approximately 241.2 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. It is reactive towards nucleophiles due to its phosphonate functionality, making it interesting for various chemical transformations.

About

CAS No 57443-18-2
English Name benzyl 2-(dimethyl phosphono)acetate
Molecular Formula C11H15O5P
Molecular Weight 258.21 g/mol
SMILES COP(=O)(CC(=O)OCC1=CC=CC=C1)OC
InChIKey QYLGNJMIOVHLQQ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2) typically synthesized?

Benzyl 2-(dimethyl phosphono)acetate is typically synthesized through esterification of dimethyl pho...

Compound Q&A

What industries use benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2)?

Benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2)?

When handling benzyl 2-(dimethyl phosphono)acetate (CAS: 57443-18-2), it is essential to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...