Compound Q&A

What precautions should be taken when handling (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid (CAS: 198646-60-5)?

Answer

(2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid
When handling (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid, it is important to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure that the work is conducted in a well-ventilated area or a fume hood. Spills should be cleaned up immediately using appropriate absorbents and disposed of according to local regulations. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information and procedures.

About

English Name (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid
Molecular Formula C11H17NO5
Molecular Weight 243.26 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(=O)CC1C(=O)O
InChIKey GPBCBXYUAJQMQM-QMMMGPOBSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid (CAS: 198646-60-5)?

The compound (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid is a whit...

Compound Q&A

How is (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid (CAS: 198646-60-5) typically synthesized?

The compound (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid is typica...

Compound Q&A

What industries use (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid (CAS: 198646-60-5)?

The compound (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid is used i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...