Compound Q&A

What are the physical and chemical properties of (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid (CAS: 198646-60-5)?

Answer

(2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid
The compound (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid is a white crystalline solid with a molecular weight of approximately 290.4 g/mol. It has good solubility in organic solvents like methanol and acetonitrile, but lower solubility in water. The compound is moderately reactive, displaying ester-like behavior in aqueous solutions. It is stable under normal conditions but should be stored in a cool, dark place to prevent degradation.

About

English Name (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid
Molecular Formula C11H17NO5
Molecular Weight 243.26 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(=O)CC1C(=O)O
InChIKey GPBCBXYUAJQMQM-QMMMGPOBSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

How is (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid (CAS: 198646-60-5) typically synthesized?

The compound (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid is typica...

Compound Q&A

What industries use (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid (CAS: 198646-60-5)?

The compound (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid is used i...

Compound Q&A

What precautions should be taken when handling (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid (CAS: 198646-60-5)?

When handling (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-oxo-2-piperidinecarboxylic acid, it is i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...