Compound Q&A

What are the physical and chemical properties of N-{2-[4-(2-Methoxyphenyl)-1-piperazinyl]ethyl}-N-(2-pyridinyl)cyclohexanecarboxamide (2Z)-2-butenedioate (1:1) (CAS: 634908-75-1)?

Answer

N-{2-[4-(2-Methoxyphenyl)-1-piperazinyl]ethyl}-N-(2-pyridinyl)cyclohexanecarboxamide (2Z)-2-butenedioate (1:1)
This compound has a crystalline form with a molecular weight of approximately 632.5 g/mol. It is slightly soluble in water and has good solubility in organic solvents like methanol and acetonitrile. Chemically, it is stable under normal conditions but can react with strong acids and bases. Its reactivity is moderate, with potential for ring-opening reactions under certain conditions.

About

English Name N-{2-[4-(2-Methoxyphenyl)-1-piperazinyl]ethyl}-N-(2-pyridinyl)cyclohexanecarboxamide (2Z)-2-butenedioate (1:1)
Molecular Formula C29H38N4O6
Molecular Weight 538.65 g/mol
SMILES O=C(C1CCCCC1)N(CCN2CCN(C3=CC=CC=C3OC)CC2)C4=NC=CC=C4.O=C(O)/C=C\C(O)=O
InChIKey XIGAHNVCEFUYOV-BTJKTKAUSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

How is N-{2-[4-(2-Methoxyphenyl)-1-piperazinyl]ethyl}-N-(2-pyridinyl)cyclohexanecarboxamide (2Z)-2-butenedioate (1:1) (CAS: 634908-75-1) typically synthesized?

This compound is synthesized via a multi-step process involving the coupling of a piperazine derivat...

Compound Q&A

What industries use N-{2-[4-(2-Methoxyphenyl)-1-piperazinyl]ethyl}-N-(2-pyridinyl)cyclohexanecarboxamide (2Z)-2-butenedioate (1:1) (CAS: 634908-75-1)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug candidate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...