Compound Q&A

What industries use Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate (CAS: 124750-59-0)?

Answer

Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate
Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate is used in various industries. In pharmaceuticals, it serves as a precursor for the synthesis of biologically active compounds. In polymers and functional materials, it can enhance the properties of materials such as conductivity and mechanical strength. Additionally, it has applications in sensors and semiconductors.

About

English Name Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate
Molecular Formula C10H14N2O4
Molecular Weight 226.23 g/mol
SMILES CCCC1=NC(=C(N1)C(=O)OC)C(=O)OC
InChIKey FGBHVVBYDOTMMD-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate (CAS: 124750-59-0)?

Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate is a white crystalline solid with a molecular weigh...

Compound Q&A

How is Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate (CAS: 124750-59-0) typically synthesized?

Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate is synthesized through a multi-step process involvi...

Compound Q&A

What precautions should be taken when handling Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate (CAS: 124750-59-0)?

When handling Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate, it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...