Compound Q&A

What are the physical and chemical properties of Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate (CAS: 124750-59-0)?

Answer

Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate
Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate is a white crystalline solid with a molecular weight of 250.29 g/mol. It has low solubility in water but is soluble in common organic solvents such as ethanol and DMSO. Chemically, it is stable but exhibits reactivity under basic conditions. It is often used as a building block in organic synthesis and has potential applications in pharmaceuticals and functional materials.

About

English Name Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate
Molecular Formula C10H14N2O4
Molecular Weight 226.23 g/mol
SMILES CCCC1=NC(=C(N1)C(=O)OC)C(=O)OC
InChIKey FGBHVVBYDOTMMD-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

How is Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate (CAS: 124750-59-0) typically synthesized?

Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate is synthesized through a multi-step process involvi...

Compound Q&A

What industries use Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate (CAS: 124750-59-0)?

Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate is used in various industries. In pharmaceuticals, ...

Compound Q&A

What precautions should be taken when handling Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate (CAS: 124750-59-0)?

When handling Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate, it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...