Compound Q&A

How is (2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine (CAS: 71620-89-8) typically synthesized?

Answer

(2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine
(2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine (CAS: 71620-89-8) can be synthesized through a multistep reaction involving morpholine, 2-ethoxyphenol, and phenylmagnesium bromide. This reaction typically requires the use of a catalytic amount of a metal compound, such as lithium bromide, and proceeds under anhydrous conditions. The reaction yields a mixture that can be purified by recrystallization or column chromatography.

About

CAS No 71620-89-8
English Name (2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine
Molecular Formula C19H23NO3
Molecular Weight 313.39700000000005 g/mol
SMILES CCOC1=CC=CC=C1OC(C2CNCCO2)C3=CC=CC=C3
InChIKey CBQGYUDMJHNJBX-MOPGFXCFSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine (CAS: 71620-89-8)?

(2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine (CAS: 71620-89-8) is a white crystalline soli...

Compound Q&A

What industries use (2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine (CAS: 71620-89-8)?

(2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine (CAS: 71620-89-8) is primarily used in pharma...

Compound Q&A

What precautions should be taken when handling (2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine (CAS: 71620-89-8)?

When handling (2R)-2-[(S)-(2-Ethoxyphenoxy)(phenyl)methyl]morpholine (CAS: 71620-89-8), it is essent...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...