Compound Q&A

What industries use Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1)?

Answer

Ethyl 1,3-benzothiazol-2-ylacetate
Ethyl 1,3-benzothiazol-2-ylacetate is used in various industries, including pharmaceuticals, where it functions as a precursor for synthesizing bioactive compounds. It is also utilized in organic synthesis and the production of sensors and semiconductors due to its unique chemical properties.

About

CAS No 29182-42-1
English Name Ethyl 1,3-benzothiazol-2-ylacetate
Molecular Formula C11H11NO2S
Molecular Weight 221.28 g/mol
SMILES CCOC(=O)CC1=NC2=CC=CC=C2S1
InChIKey VYMJUZXFYAREJY-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1)?

Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1) is a crystalline compound with a molecular weig...

Compound Q&A

How is Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1) typically synthesized?

Ethyl 1,3-benzothiazol-2-ylacetate is typically synthesized via the acylation of 1,3-benzothiazol-2-...

Compound Q&A

What precautions should be taken when handling Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1)?

When handling Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1), it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...