Compound Q&A

What are the physical and chemical properties of Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1)?

Answer

Ethyl 1,3-benzothiazol-2-ylacetate
Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1) is a crystalline compound with a molecular weight of approximately 222.24 g/mol. It is soluble in organic solvents like ethanol and acetone but has limited water solubility. The compound exhibits moderate reactivity towards nucleophiles and electrophiles, suitable for various synthetic transformations.

About

CAS No 29182-42-1
English Name Ethyl 1,3-benzothiazol-2-ylacetate
Molecular Formula C11H11NO2S
Molecular Weight 221.28 g/mol
SMILES CCOC(=O)CC1=NC2=CC=CC=C2S1
InChIKey VYMJUZXFYAREJY-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:29

Related Q&A

Compound Q&A

How is Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1) typically synthesized?

Ethyl 1,3-benzothiazol-2-ylacetate is typically synthesized via the acylation of 1,3-benzothiazol-2-...

Compound Q&A

What industries use Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1)?

Ethyl 1,3-benzothiazol-2-ylacetate is used in various industries, including pharmaceuticals, where i...

Compound Q&A

What precautions should be taken when handling Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1)?

When handling Ethyl 1,3-benzothiazol-2-ylacetate (CAS: 29182-42-1), it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...