Compound Q&A

How is 2,3,6-Trichloro-5-(trifluoromethyl)pyridine (CAS: 80289-91-4) typically synthesized?

Answer

2,3,6-Trichloro-5-(trifluoromethyl)pyridine
2,3,6-Trichloro-5-(trifluoromethyl)pyridine is commonly synthesized via electrophilic aromatic substitution. The reaction involves chlorination and trifluoromethylation of pyridine using appropriate reagents. Catalysts such as PCC (Pyridinium chlorochromate) are often used to achieve high selectivity and yield.

About

CAS No 80289-91-4
English Name 2,3,6-Trichloro-5-(trifluoromethyl)pyridine
Molecular Formula C6HCl3F3N
Molecular Weight 250.43 g/mol
SMILES C1=C(C(=NC(=C1Cl)Cl)Cl)C(F)(F)F
InChIKey ZJNBCPFIEDYDFH-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,6-Trichloro-5-(trifluoromethyl)pyridine (CAS: 80289-91-4)?

2,3,6-Trichloro-5-(trifluoromethyl)pyridine is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 2,3,6-Trichloro-5-(trifluoromethyl)pyridine (CAS: 80289-91-4)?

2,3,6-Trichloro-5-(trifluoromethyl)pyridine is used in various industries, including pharmaceuticals...

Compound Q&A

What precautions should be taken when handling 2,3,6-Trichloro-5-(trifluoromethyl)pyridine (CAS: 80289-91-4)?

When handling 2,3,6-Trichloro-5-(trifluoromethyl)pyridine, appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...