Compound Q&A

What are the physical and chemical properties of 2,3,6-Trichloro-5-(trifluoromethyl)pyridine (CAS: 80289-91-4)?

Answer

2,3,6-Trichloro-5-(trifluoromethyl)pyridine
2,3,6-Trichloro-5-(trifluoromethyl)pyridine is a crystalline solid with a molecular weight of approximately 308.03 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. The compound is moderately reactive, particularly towards nucleophilic reagents.

About

CAS No 80289-91-4
English Name 2,3,6-Trichloro-5-(trifluoromethyl)pyridine
Molecular Formula C6HCl3F3N
Molecular Weight 250.43 g/mol
SMILES C1=C(C(=NC(=C1Cl)Cl)Cl)C(F)(F)F
InChIKey ZJNBCPFIEDYDFH-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 2,3,6-Trichloro-5-(trifluoromethyl)pyridine (CAS: 80289-91-4) typically synthesized?

2,3,6-Trichloro-5-(trifluoromethyl)pyridine is commonly synthesized via electrophilic aromatic subst...

Compound Q&A

What industries use 2,3,6-Trichloro-5-(trifluoromethyl)pyridine (CAS: 80289-91-4)?

2,3,6-Trichloro-5-(trifluoromethyl)pyridine is used in various industries, including pharmaceuticals...

Compound Q&A

What precautions should be taken when handling 2,3,6-Trichloro-5-(trifluoromethyl)pyridine (CAS: 80289-91-4)?

When handling 2,3,6-Trichloro-5-(trifluoromethyl)pyridine, appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...