Compound Q&A

What industries use 2-Methyl-2-proanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate (CAS: 864771-44-8)?

Answer

2-Methyl-2-propanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate
This compound is used in the pharmaceutical industry for its potential as an intermediate in drug synthesis. It is also used in the development of new materials and sensors, particularly in the field of optoelectronics due to its unique optical properties.

About

English Name 2-Methyl-2-propanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate
Molecular Formula C18H25BN2O4
Molecular Weight 344.22 g/mol
SMILES CC(C)(C)OC(=O)n1ncc2cc(ccc12)B3OC(C)(C)C(C)(C)O3
InChIKey MMXDKXUKSKMROG-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate (CAS: 864771-44-8)?

The compound has a crystalline form with a molecular weight of approximately 518.48 g/mol. It is poo...

Compound Q&A

How is 2-Methyl-2-proanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate (CAS: 864771-44-8) typically synthesized?

The compound is typically synthesized using a palladium-catalyzed coupling reaction between 2-methyl...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate (CAS: 864771-44-8)?

When handling this compound, protective gloves and eye protection are recommended. It should be stor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...