Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate (CAS: 864771-44-8)?

Answer

2-Methyl-2-propanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate
The compound has a crystalline form with a molecular weight of approximately 518.48 g/mol. It is poorly soluble in water but soluble in organic solvents like DMSO and DMF. Chemically, it is stable under normal conditions but can react with strong acids or bases. Its reactivity is due to the presence of the dioxaborolane moiety.

About

English Name 2-Methyl-2-propanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate
Molecular Formula C18H25BN2O4
Molecular Weight 344.22 g/mol
SMILES CC(C)(C)OC(=O)n1ncc2cc(ccc12)B3OC(C)(C)C(C)(C)O3
InChIKey MMXDKXUKSKMROG-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 2-Methyl-2-proanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate (CAS: 864771-44-8) typically synthesized?

The compound is typically synthesized using a palladium-catalyzed coupling reaction between 2-methyl...

Compound Q&A

What industries use 2-Methyl-2-proanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate (CAS: 864771-44-8)?

This compound is used in the pharmaceutical industry for its potential as an intermediate in drug sy...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate (CAS: 864771-44-8)?

When handling this compound, protective gloves and eye protection are recommended. It should be stor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...