Compound Q&A

What industries use H-Val-Ala-OH (CAS: 27493-61-4)?

Answer

H-Val-Ala-OH
H-Val-Ala-OH (CAS: 27493-61-4) is primarily used in the pharmaceutical industry for the development of bioactive peptides and as a research tool. It is also utilized in the polymer industry for the synthesis of biodegradable polymers and in the sensor industry for the creation of biosensors. Additionally, it is used in semiconductor applications for the fabrication of thin films.

About

CAS No 27493-61-4
English Name H-Val-Ala-OH
Molecular Formula C8H16N2O3
Molecular Weight 188.23 g/mol
SMILES CC(C)C(C(=O)NC(C)C(=O)O)N
InChIKey HSRXSKHRSXRCFC-WDSKDSINSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of H-Val-Ala-OH (CAS: 27493-61-4)?

H-Val-Ala-OH (CAS: 27493-61-4) is a crystalline compound with a molecular weight of approximately 16...

Compound Q&A

How is H-Val-Ala-OH (CAS: 27493-61-4) typically synthesized?

H-Val-Ala-OH (CAS: 27493-61-4) is typically synthesized via a solid-phase peptide synthesis method. ...

Compound Q&A

What precautions should be taken when handling H-Val-Ala-OH (CAS: 27493-61-4)?

When handling H-Val-Ala-OH (CAS: 27493-61-4), it is essential to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...