Compound Q&A

What industries use 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid (CAS: 933047-52-0)?

Answer

4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid
4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid is used in various industries, including pharmaceuticals, where it can act as a precursor for certain drug compounds, and in the development of sensors and semiconductors due to its unique optical and electronic properties.

About

English Name 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid
Molecular Formula C44H26O8
Molecular Weight 682.68 g/mol
SMILES C1=CC(=CC=C1C2=CC(=C3C=CC4=C(C=C(C5=C4C3=C2C=C5)C6=CC=C(C=C6)C(=O)O)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O)C(=O)O
InChIKey HVCDAMXLLUJLQZ-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid (CAS: 933047-52-0)?

4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid is a crystalline compound with a high molecu...

Compound Q&A

How is 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid (CAS: 933047-52-0) typically synthesized?

4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid is synthesized through a multi-step process ...

Compound Q&A

What precautions should be taken when handling 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid (CAS: 933047-52-0)?

When handling 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid, it is essential to use proper...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...