Compound Q&A

How is 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid (CAS: 933047-52-0) typically synthesized?

Answer

4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid
4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid is synthesized through a multi-step process involving coupling reactions and condensation reactions. Commonly, it involves the use of pyrene and benzoic acid derivatives, with the reaction typically carried out under mild to moderate conditions to achieve high selectivity and yield.

About

English Name 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid
Molecular Formula C44H26O8
Molecular Weight 682.68 g/mol
SMILES C1=CC(=CC=C1C2=CC(=C3C=CC4=C(C=C(C5=C4C3=C2C=C5)C6=CC=C(C=C6)C(=O)O)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O)C(=O)O
InChIKey HVCDAMXLLUJLQZ-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid (CAS: 933047-52-0)?

4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid is a crystalline compound with a high molecu...

Compound Q&A

What industries use 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid (CAS: 933047-52-0)?

4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid is used in various industries, including pha...

Compound Q&A

What precautions should be taken when handling 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid (CAS: 933047-52-0)?

When handling 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetrabenzoic acid, it is essential to use proper...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...