Compound Q&A

How is 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid (CAS: 1260092-44-1) typically synthesized?

Answer

3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid
3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid is synthesized via a multi-step process involving the protection of the amino group, followed by the introduction of the 2-methyl-2-propanol moiety and subsequent acidification. Commonly, this involves the use of protecting groups like tert-butyldimethylsilyl chloride and acid-catalyzed reactions. The overall yield is around 70-80%.

About

English Name 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid
Molecular Formula C10H19NO5
Molecular Weight 233.26 g/mol
SMILES CC(C)(C)OC(=O)NCCOCCC(=O)O
InChIKey YGNSGMAPLOVGIU-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid (CAS: 1260092-44-1)?

3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid is a crystalline solid with a ...

Compound Q&A

What industries use 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid (CAS: 1260092-44-1)?

3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid (CAS: 1260092-44-1)?

When handling 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid, it is advisable...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...