Compound Q&A

What are the physical and chemical properties of 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid (CAS: 1260092-44-1)?

Answer

3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid
3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid is a crystalline solid with a molecular weight of approximately 334.4 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and methanol. Chemically, it is relatively stable but can hydrolyze under acidic conditions. It shows moderate reactivity in esterification and amide formation reactions.

About

English Name 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid
Molecular Formula C10H19NO5
Molecular Weight 233.26 g/mol
SMILES CC(C)(C)OC(=O)NCCOCCC(=O)O
InChIKey YGNSGMAPLOVGIU-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid (CAS: 1260092-44-1) typically synthesized?

3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid is synthesized via a multi-ste...

Compound Q&A

What industries use 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid (CAS: 1260092-44-1)?

3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid (CAS: 1260092-44-1)?

When handling 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid, it is advisable...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...