Compound Q&A

What industries use 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate (CAS: 405939-39-1)?

Answer

2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate
2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate is primarily used in the pharmaceutical industry for the synthesis of various medicinal compounds. It also finds applications in the polymer industry for preparing functionalized polymers with specific chemical properties. Additionally, it can be utilized in the development of chemical sensors and semiconductor materials.

About

English Name 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate
Molecular Formula C8H11BrN2O2S
Molecular Weight 279.159 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(S1)Br
InChIKey OIBKBVFFZYCBAQ-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate (CAS: 405939-39-1)?

2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate is a crystalline compound with a molecular w...

Compound Q&A

How is 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate (CAS: 405939-39-1) typically synthesized?

2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate is typically synthesized through nucleophili...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate (CAS: 405939-39-1)?

When handling 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate, it is essential to work in a ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...