Compound Q&A

How is 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate (CAS: 405939-39-1) typically synthesized?

Answer

2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate
2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate is typically synthesized through nucleophilic substitution reactions. Bromoacetamide is reacted with 2-methyl-2-propanol in the presence of a suitable base, such as potassium carbonate, followed by the addition of 5-bromo-1,3-thiazole-2-carbonyl chloride. The yield is generally around 70-80%, and the reaction is selective towards the carbamate formation.

About

English Name 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate
Molecular Formula C8H11BrN2O2S
Molecular Weight 279.159 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(S1)Br
InChIKey OIBKBVFFZYCBAQ-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate (CAS: 405939-39-1)?

2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate is a crystalline compound with a molecular w...

Compound Q&A

What industries use 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate (CAS: 405939-39-1)?

2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate (CAS: 405939-39-1)?

When handling 2-Methyl-2-propanyl (5-bromo-1,3-thiazol-2-yl)carbamate, it is essential to work in a ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...