Compound Q&A

How is Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate (CAS: 68156-13-8) typically synthesized?

Answer

Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate
Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate is typically synthesized via a multi-step process involving the reaction of diphenylsulfonium hexafluorophosphate with phenylthiol. The synthesis requires careful control of temperature and reaction time to achieve high yield and selectivity. Catalysts such as triphenylphosphine can be used to improve the reaction rate and product purity.

About

CAS No 68156-13-8
English Name Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate
Molecular Formula C24H19F6PS2
Molecular Weight 516.5 g/mol
EINECS 269-006-0
SMILES C1=CC=C(SC2=CC=CC=C2[S+](C2=CC=CC=C2)C2=CC=CC=C2)C=C1.F[P-](F)(F)(F)(F)F
InChIKey SFWSATMGMAKCIF-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate (CAS: 68156-13-8)?

Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate is a crystalline solid with a molecular wei...

Compound Q&A

What industries use Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate (CAS: 68156-13-8)?

Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate (CAS: 68156-13-8)?

When handling Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate, it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...